C23H23N3O3 — CID 137291968
N-[1-(1-benzofuran-2-yl)ethyl]-N-methyl-4-(4-oxo-3H-quinazolin-2-yl)butanamide (PubChem CID 137291968) has the molecular formula C23H23N3O3 and a molecular weight of 389.46 g/mol. Its IUPAC name is N-[1-(1-benzofuran-2-yl)ethyl]-N-methyl-4-(4-oxo-3H-quinazolin-2-yl)butanamide.
| Compound Name | N-[1-(1-benzofuran-2-yl)ethyl]-N-methyl-4-(4-oxo-3H-quinazolin-2-yl)butanamide |
|---|---|
| PubChem CID | 137291968 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | N-[1-(1-benzofuran-2-yl)ethyl]-N-methyl-4-(4-oxo-3H-quinazolin-2-yl)butanamide |
| SMILES | CC(c1cc2ccccc2o1)N(C)C(=O)CCCc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C23H23N3O3/c1-15(20-14-16-8-3-6-11-19(16)29-20)26(2)22(27)13-7-12-21-24-18-10-5-4-9-17(18)23(28)25-21/h3-6,8-11,14-15H,7,12-13H2,1-2H3,(H,24,25,28) |
| InChIKey | GVPQOZQLLIMIJH-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |