C16H20ClNO2 — CID 63681322
N-[1-(1-benzofuran-2-yl)ethyl]-3-chloro-N,2,2-trimethylpropanamide (PubChem CID 63681322) has the molecular formula C16H20ClNO2 and a molecular weight of 293.79 g/mol. Its IUPAC name is N-[1-(1-benzofuran-2-yl)ethyl]-3-chloro-N,2,2-trimethylpropanamide.
| Compound Name | N-[1-(1-benzofuran-2-yl)ethyl]-3-chloro-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 63681322 |
| Molecular Formula | C16H20ClNO2 |
| Molecular Weight | 293.79 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | N-[1-(1-benzofuran-2-yl)ethyl]-3-chloro-N,2,2-trimethylpropanamide |
| SMILES | CC(c1cc2ccccc2o1)N(C)C(=O)C(C)(C)CCl |
| InChI | InChI=1S/C16H20ClNO2/c1-11(18(4)15(19)16(2,3)10-17)14-9-12-7-5-6-8-13(12)20-14/h5-9,11H,10H2,1-4H3 |
| InChIKey | DRUJAPFCHSRJML-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.79 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|