C23H28N4O7S — CID 18753647
N-hydroxy-2-[methyl-(4-phenoxyphenyl)sulfonylamino]-4-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)butanamide (PubChem CID 18753647) has the molecular formula C23H28N4O7S and a molecular weight of 504.57 g/mol. Its IUPAC name is N-hydroxy-2-[methyl-(4-phenoxyphenyl)sulfonylamino]-4-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)butanamide.
| Compound Name | N-hydroxy-2-[methyl-(4-phenoxyphenyl)sulfonylamino]-4-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)butanamide |
|---|---|
| PubChem CID | 18753647 |
| Molecular Formula | C23H28N4O7S |
| Molecular Weight | 504.57 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | N-hydroxy-2-[methyl-(4-phenoxyphenyl)sulfonylamino]-4-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)butanamide |
| SMILES | CN1C(=O)N(CCC(C(=O)NO)N(C)S(=O)(=O)c2ccc(Oc3ccccc3)cc2)C(=O)C1(C)C |
| InChI | InChI=1S/C23H28N4O7S/c1-23(2)21(29)27(22(30)25(23)3)15-14-19(20(28)24-31)26(4)35(32,33)18-12-10-17(11-13-18)34-16-8-6-5-7-9-16/h5-13,19,31H,14-15H2,1-4H3,(H,24,28) |
| InChIKey | JUXRHMGQOLCABL-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 136.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.57 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|