C19H17NO5S — CID 53400137
ethyl 2-(3-benzylidene-1,1,4-trioxo-1λ6,2-benzothiazin-2-yl)acetate (PubChem CID 53400137) has the molecular formula C19H17NO5S and a molecular weight of 371.41 g/mol. Its IUPAC name is ethyl 2-(3-benzylidene-1,1,4-trioxo-1λ6,2-benzothiazin-2-yl)acetate.
| Compound Name | ethyl 2-(3-benzylidene-1,1,4-trioxo-1λ6,2-benzothiazin-2-yl)acetate |
|---|---|
| PubChem CID | 53400137 |
| Molecular Formula | C19H17NO5S |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | ethyl 2-(3-benzylidene-1,1,4-trioxo-1λ6,2-benzothiazin-2-yl)acetate |
| SMILES | CCOC(=O)CN1C(=Cc2ccccc2)C(=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C19H17NO5S/c1-2-25-18(21)13-20-16(12-14-8-4-3-5-9-14)19(22)15-10-6-7-11-17(15)26(20,23)24/h3-12H,2,13H2,1H3 |
| InChIKey | WFBRGCCPMAEREM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|