C51H34O4S — CID 170366128
2-[[7-[5-[(1,3-dioxoinden-2-ylidene)methyl]thiophen-2-yl]-9,9-bis(4-methylphenyl)-5,6-dihydrofluoren-2-yl]methylidene]indene-1,3-dione (PubChem CID 170366128) has the molecular formula C51H34O4S and a molecular weight of 742.90 g/mol. Its IUPAC name is 2-[[7-[5-[(1,3-dioxoinden-2-ylidene)methyl]thiophen-2-yl]-9,9-bis(4-methylphenyl)-5,6-dihydrofluoren-2-yl]methylidene]indene-1,3-dione.
| Compound Name | 2-[[7-[5-[(1,3-dioxoinden-2-ylidene)methyl]thiophen-2-yl]-9,9-bis(4-methylphenyl)-5,6-dihydrofluoren-2-yl]methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 170366128 |
| Molecular Formula | C51H34O4S |
| Molecular Weight | 742.90 g/mol |
| Exact Mass | 742.22 |
| IUPAC Name | 2-[[7-[5-[(1,3-dioxoinden-2-ylidene)methyl]thiophen-2-yl]-9,9-bis(4-methylphenyl)-5,6-dihydrofluoren-2-yl]methylidene]indene-1,3-dione |
| SMILES | Cc1ccc(C2(c3ccc(C)cc3)C3=C(CCC(c4ccc(C=C5C(=O)c6ccccc6C5=O)s4)=C3)c3ccc(C=C4C(=O)c5ccccc5C4=O)cc32)cc1 |
| InChI | InChI=1S/C51H34O4S/c1-29-11-17-33(18-12-29)51(34-19-13-30(2)14-20-34)44-26-31(25-42-47(52)38-7-3-4-8-39(38)48(42)53)15-22-36(44)37-23-16-32(27-45(37)51)46-24-21-35(56-46)28-43-49(54)40-9-5-6-10-41(40)50(43)55/h3-15,17-22,24-28H,16,23H2,1-2H3 |
| InChIKey | YTHUDIXZPZTHCN-UHFFFAOYSA-N |
| XLogP | 11.27 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.90 |
| LogP ≤ 5 | 11.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|