C45H28O4 — CID 170366098
2-[[6-[7-[(1,3-dioxoinden-2-ylidene)methyl]-9,9-dimethylfluoren-2-yl]naphthalen-2-yl]methylidene]indene-1,3-dione (PubChem CID 170366098) has the molecular formula C45H28O4 and a molecular weight of 632.72 g/mol. Its IUPAC name is 2-[[6-[7-[(1,3-dioxoinden-2-ylidene)methyl]-9,9-dimethylfluoren-2-yl]naphthalen-2-yl]methylidene]indene-1,3-dione.
| Compound Name | 2-[[6-[7-[(1,3-dioxoinden-2-ylidene)methyl]-9,9-dimethylfluoren-2-yl]naphthalen-2-yl]methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 170366098 |
| Molecular Formula | C45H28O4 |
| Molecular Weight | 632.72 g/mol |
| Exact Mass | 632.20 |
| IUPAC Name | 2-[[6-[7-[(1,3-dioxoinden-2-ylidene)methyl]-9,9-dimethylfluoren-2-yl]naphthalen-2-yl]methylidene]indene-1,3-dione |
| SMILES | CC1(C)c2cc(C=C3C(=O)c4ccccc4C3=O)ccc2-c2ccc(-c3ccc4cc(C=C5C(=O)c6ccccc6C5=O)ccc4c3)cc21 |
| InChI | InChI=1S/C45H28O4/c1-45(2)39-22-26(21-38-43(48)35-9-5-6-10-36(35)44(38)49)12-17-31(39)32-18-16-30(24-40(32)45)29-15-14-27-19-25(11-13-28(27)23-29)20-37-41(46)33-7-3-4-8-34(33)42(37)47/h3-24H,1-2H3 |
| InChIKey | SHMGZSWYLKOWNC-UHFFFAOYSA-N |
| XLogP | 9.74 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.72 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|