C58H53NO2 — CID 58175010
2-[[6-[bis[9,9-di(propan-2-yl)fluoren-2-yl]amino]naphthalen-2-yl]methylidene]indene-1,3-dione (PubChem CID 58175010) has the molecular formula C58H53NO2 and a molecular weight of 796.07 g/mol. Its IUPAC name is 2-[[6-[bis[9,9-di(propan-2-yl)fluoren-2-yl]amino]naphthalen-2-yl]methylidene]indene-1,3-dione.
| Compound Name | 2-[[6-[bis[9,9-di(propan-2-yl)fluoren-2-yl]amino]naphthalen-2-yl]methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 58175010 |
| Molecular Formula | C58H53NO2 |
| Molecular Weight | 796.07 g/mol |
| Exact Mass | 795.41 |
| IUPAC Name | 2-[[6-[bis[9,9-di(propan-2-yl)fluoren-2-yl]amino]naphthalen-2-yl]methylidene]indene-1,3-dione |
| SMILES | CC(C)C1(C(C)C)c2ccccc2-c2ccc(N(c3ccc4c(c3)C(C(C)C)(C(C)C)c3ccccc3-4)c3ccc4cc(C=C5C(=O)c6ccccc6C5=O)ccc4c3)cc21 |
| InChI | InChI=1S/C58H53NO2/c1-34(2)57(35(3)4)51-19-13-11-15-44(51)46-27-25-42(32-53(46)57)59(43-26-28-47-45-16-12-14-20-52(45)58(36(5)6,37(7)8)54(47)33-43)41-24-23-39-29-38(21-22-40(39)31-41)30-50-55(60)48-17-9-10-18-49(48)56(50)61/h9-37H,1-8H3 |
| InChIKey | SZLMVMSBJJXDBP-UHFFFAOYSA-N |
| XLogP | 14.93 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.07 |
| LogP ≤ 5 | 14.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|