C63H57N3O3S2 — CID 76609759
4-[[5-[5-[4-[bis[9,9-di(propan-2-yl)fluoren-2-yl]amino]phenyl]thiophen-2-yl]thiophen-2-yl]methylidene]-5-oxo-1-phenylpyrazole-3-carboxylic acid (PubChem CID 76609759) has the molecular formula C63H57N3O3S2 and a molecular weight of 968.30 g/mol. Its IUPAC name is 4-[[5-[5-[4-[bis[9,9-di(propan-2-yl)fluoren-2-yl]amino]phenyl]thiophen-2-yl]thiophen-2-yl]methylidene]-5-oxo-1-phenylpyrazole-3-carboxylic acid.
| Compound Name | 4-[[5-[5-[4-[bis[9,9-di(propan-2-yl)fluoren-2-yl]amino]phenyl]thiophen-2-yl]thiophen-2-yl]methylidene]-5-oxo-1-phenylpyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 76609759 |
| Molecular Formula | C63H57N3O3S2 |
| Molecular Weight | 968.30 g/mol |
| Exact Mass | 967.38 |
| IUPAC Name | 4-[[5-[5-[4-[bis[9,9-di(propan-2-yl)fluoren-2-yl]amino]phenyl]thiophen-2-yl]thiophen-2-yl]methylidene]-5-oxo-1-phenylpyrazole-3-carboxylic acid |
| SMILES | CC(C)C1(C(C)C)c2ccccc2-c2ccc(N(c3ccc(-c4ccc(-c5ccc(C=C6C(=O)N(c7ccccc7)N=C6C(=O)O)s5)s4)cc3)c3ccc4c(c3)C(C(C)C)(C(C)C)c3ccccc3-4)cc21 |
| InChI | InChI=1S/C63H57N3O3S2/c1-37(2)62(38(3)4)52-20-14-12-18-47(52)49-29-26-44(34-54(49)62)65(45-27-30-50-48-19-13-15-21-53(48)63(39(5)6,40(7)8)55(50)35-45)42-24-22-41(23-25-42)56-32-33-58(71-56)57-31-28-46(70-57)36-51-59(61(68)69)64-66(60(51)67)43-16-10-9-11-17-43/h9-40H,1-8H3,(H,68,69) |
| InChIKey | ZXCQHEUJBSUCFR-UHFFFAOYSA-N |
| XLogP | 16.64 |
| TPSA | 73.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 968.30 |
| LogP ≤ 5 | 16.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|