C47H37NOS2 — CID 102328070
(E)-3-[5-[5-[4-[bis(9,9-dimethylfluoren-2-yl)amino]phenyl]thiophen-2-yl]thiophen-2-yl]prop-2-enal (PubChem CID 102328070) has the molecular formula C47H37NOS2 and a molecular weight of 695.95 g/mol. Its IUPAC name is (E)-3-[5-[5-[4-[bis(9,9-dimethylfluoren-2-yl)amino]phenyl]thiophen-2-yl]thiophen-2-yl]prop-2-enal.
| Compound Name | (E)-3-[5-[5-[4-[bis(9,9-dimethylfluoren-2-yl)amino]phenyl]thiophen-2-yl]thiophen-2-yl]prop-2-enal |
|---|---|
| PubChem CID | 102328070 |
| Molecular Formula | C47H37NOS2 |
| Molecular Weight | 695.95 g/mol |
| Exact Mass | 695.23 |
| IUPAC Name | (E)-3-[5-[5-[4-[bis(9,9-dimethylfluoren-2-yl)amino]phenyl]thiophen-2-yl]thiophen-2-yl]prop-2-enal |
| SMILES | CC1(C)c2ccccc2-c2ccc(N(c3ccc(-c4ccc(-c5ccc(/C=C/C=O)s5)s4)cc3)c3ccc4c(c3)C(C)(C)c3ccccc3-4)cc21 |
| InChI | InChI=1S/C47H37NOS2/c1-46(2)39-13-7-5-11-35(39)37-22-19-32(28-41(37)46)48(33-20-23-38-36-12-6-8-14-40(36)47(3,4)42(38)29-33)31-17-15-30(16-18-31)43-25-26-45(51-43)44-24-21-34(50-44)10-9-27-49/h5-29H,1-4H3/b10-9+ |
| InChIKey | PZTIDJPINJYDBO-MDZDMXLPSA-N |
| XLogP | 13.44 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.95 |
| LogP ≤ 5 | 13.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|