C50H36N2O2S3 — CID 177431954
(Z)-3-[5-[2-[4-[bis(9,9-dimethylfluoren-2-yl)amino]phenyl]thieno[3,2-b]thiophen-5-yl]thiophen-2-yl]-2-cyanoprop-2-enoic acid (PubChem CID 177431954) has the molecular formula C50H36N2O2S3 and a molecular weight of 793.05 g/mol. Its IUPAC name is (Z)-3-[5-[2-[4-[bis(9,9-dimethylfluoren-2-yl)amino]phenyl]thieno[3,2-b]thiophen-5-yl]thiophen-2-yl]-2-cyanoprop-2-enoic acid.
| Compound Name | (Z)-3-[5-[2-[4-[bis(9,9-dimethylfluoren-2-yl)amino]phenyl]thieno[3,2-b]thiophen-5-yl]thiophen-2-yl]-2-cyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 177431954 |
| Molecular Formula | C50H36N2O2S3 |
| Molecular Weight | 793.05 g/mol |
| Exact Mass | 792.19 |
| IUPAC Name | (Z)-3-[5-[2-[4-[bis(9,9-dimethylfluoren-2-yl)amino]phenyl]thieno[3,2-b]thiophen-5-yl]thiophen-2-yl]-2-cyanoprop-2-enoic acid |
| SMILES | CC1(C)c2ccccc2-c2ccc(N(c3ccc(-c4cc5sc(-c6ccc(/C=C(/C#N)C(=O)O)s6)cc5s4)cc3)c3ccc4c(c3)C(C)(C)c3ccccc3-4)cc21 |
| InChI | InChI=1S/C50H36N2O2S3/c1-49(2)39-11-7-5-9-35(39)37-20-17-32(24-41(37)49)52(33-18-21-38-36-10-6-8-12-40(36)50(3,4)42(38)25-33)31-15-13-29(14-16-31)44-26-46-47(56-44)27-45(57-46)43-22-19-34(55-43)23-30(28-51)48(53)54/h5-27H,1-4H3,(H,53,54)/b30-23- |
| InChIKey | JKCUNJXMKSJXSP-WMMMYUQOSA-N |
| XLogP | 14.43 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.05 |
| LogP ≤ 5 | 14.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|