C52H35N3O2S3 — CID 102038732
(E)-3-[5-[5-[4,5-bis[4-(N-phenylanilino)phenyl]thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]-2-cyanoprop-2-enoic acid (PubChem CID 102038732) has the molecular formula C52H35N3O2S3 and a molecular weight of 830.07 g/mol. Its IUPAC name is (E)-3-[5-[5-[4,5-bis[4-(N-phenylanilino)phenyl]thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]-2-cyanoprop-2-enoic acid.
| Compound Name | (E)-3-[5-[5-[4,5-bis[4-(N-phenylanilino)phenyl]thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]-2-cyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 102038732 |
| Molecular Formula | C52H35N3O2S3 |
| Molecular Weight | 830.07 g/mol |
| Exact Mass | 829.19 |
| IUPAC Name | (E)-3-[5-[5-[4,5-bis[4-(N-phenylanilino)phenyl]thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]-2-cyanoprop-2-enoic acid |
| SMILES | N#C/C(=C\c1ccc(-c2ccc(-c3cc(-c4ccc(N(c5ccccc5)c5ccccc5)cc4)c(-c4ccc(N(c5ccccc5)c5ccccc5)cc4)s3)s2)s1)C(=O)O |
| InChI | InChI=1S/C52H35N3O2S3/c53-35-38(52(56)57)33-45-29-30-47(58-45)48-31-32-49(59-48)50-34-46(36-21-25-43(26-22-36)54(39-13-5-1-6-14-39)40-15-7-2-8-16-40)51(60-50)37-23-27-44(28-24-37)55(41-17-9-3-10-18-41)42-19-11-4-12-20-42/h1-34H,(H,56,57)/b38-33+ |
| InChIKey | BOKDNMPCVKSDKY-NNIBMBRCSA-N |
| XLogP | 15.47 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.07 |
| LogP ≤ 5 | 15.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|