C38H21N3O4S4 — CID 118286538
(E)-3-[5-[4-(N-[4-[2-[(E)-2-carboxy-2-cyanoethenyl]thieno[3,2-b]thiophen-5-yl]phenyl]anilino)phenyl]thieno[3,2-b]thiophen-2-yl]-2-cyanoprop-2-enoic acid (PubChem CID 118286538) has the molecular formula C38H21N3O4S4 and a molecular weight of 711.87 g/mol. Its IUPAC name is (E)-3-[5-[4-(N-[4-[2-[(E)-2-carboxy-2-cyanoethenyl]thieno[3,2-b]thiophen-5-yl]phenyl]anilino)phenyl]thieno[3,2-b]thiophen-2-yl]-2-cyanoprop-2-enoic acid.
| Compound Name | (E)-3-[5-[4-(N-[4-[2-[(E)-2-carboxy-2-cyanoethenyl]thieno[3,2-b]thiophen-5-yl]phenyl]anilino)phenyl]thieno[3,2-b]thiophen-2-yl]-2-cyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 118286538 |
| Molecular Formula | C38H21N3O4S4 |
| Molecular Weight | 711.87 g/mol |
| Exact Mass | 711.04 |
| IUPAC Name | (E)-3-[5-[4-(N-[4-[2-[(E)-2-carboxy-2-cyanoethenyl]thieno[3,2-b]thiophen-5-yl]phenyl]anilino)phenyl]thieno[3,2-b]thiophen-2-yl]-2-cyanoprop-2-enoic acid |
| SMILES | N#C/C(=C\c1cc2sc(-c3ccc(N(c4ccccc4)c4ccc(-c5cc6sc(/C=C(\C#N)C(=O)O)cc6s5)cc4)cc3)cc2s1)C(=O)O |
| InChI | InChI=1S/C38H21N3O4S4/c39-20-24(37(42)43)14-29-16-33-35(46-29)18-31(48-33)22-6-10-27(11-7-22)41(26-4-2-1-3-5-26)28-12-8-23(9-13-28)32-19-36-34(49-32)17-30(47-36)15-25(21-40)38(44)45/h1-19H,(H,42,43)(H,44,45)/b24-14+,25-15+ |
| InChIKey | FLXKLJWNNUCFQZ-KOJZRSEWSA-N |
| XLogP | 11.03 |
| TPSA | 125.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.87 |
| LogP ≤ 5 | 11.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|