C14H7NO3S2 — CID 177492561
(Z)-2-cyano-3-[5-(furan-2-yl)thieno[3,2-b]thiophen-2-yl]prop-2-enoic acid (PubChem CID 177492561) has the molecular formula C14H7NO3S2 and a molecular weight of 301.35 g/mol. Its IUPAC name is (Z)-2-cyano-3-[5-(furan-2-yl)thieno[3,2-b]thiophen-2-yl]prop-2-enoic acid.
| Compound Name | (Z)-2-cyano-3-[5-(furan-2-yl)thieno[3,2-b]thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 177492561 |
| Molecular Formula | C14H7NO3S2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 300.99 |
| IUPAC Name | (Z)-2-cyano-3-[5-(furan-2-yl)thieno[3,2-b]thiophen-2-yl]prop-2-enoic acid |
| SMILES | N#C/C(=C/c1cc2sc(-c3ccco3)cc2s1)C(=O)O |
| InChI | InChI=1S/C14H7NO3S2/c15-7-8(14(16)17)4-9-5-12-13(19-9)6-11(20-12)10-2-1-3-18-10/h1-6H,(H,16,17)/b8-4- |
| InChIKey | JJCFJVUIBWEHKI-YWEYNIOJSA-N |
| XLogP | 4.21 |
| TPSA | 74.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|