C12H7NO3S — CID 145445194
(E)-2-cyano-3-(6-hydroxy-1-benzothiophen-2-yl)prop-2-enoic acid (PubChem CID 145445194) has the molecular formula C12H7NO3S and a molecular weight of 245.26 g/mol. Its IUPAC name is (E)-2-cyano-3-(6-hydroxy-1-benzothiophen-2-yl)prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-(6-hydroxy-1-benzothiophen-2-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 145445194 |
| Molecular Formula | C12H7NO3S |
| Molecular Weight | 245.26 g/mol |
| Exact Mass | 245.01 |
| IUPAC Name | (E)-2-cyano-3-(6-hydroxy-1-benzothiophen-2-yl)prop-2-enoic acid |
| SMILES | N#C/C(=C\c1cc2ccc(O)cc2s1)C(=O)O |
| InChI | InChI=1S/C12H7NO3S/c13-6-8(12(15)16)4-10-3-7-1-2-9(14)5-11(7)17-10/h1-5,14H,(H,15,16)/b8-4+ |
| InChIKey | AUUIHIFXDONBDT-XBXARRHUSA-N |
| XLogP | 2.60 |
| TPSA | 81.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.26 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|