C20H13N3O5 — CID 158719602
2-cyano-3-(2,5-dihydroxyphenyl)prop-2-enoic acid;2-[(3-hydroxyphenyl)methylidene]propanedinitrile (PubChem CID 158719602) has the molecular formula C20H13N3O5 and a molecular weight of 375.34 g/mol. Its IUPAC name is 2-cyano-3-(2,5-dihydroxyphenyl)prop-2-enoic acid;2-[(3-hydroxyphenyl)methylidene]propanedinitrile.
| Compound Name | 2-cyano-3-(2,5-dihydroxyphenyl)prop-2-enoic acid;2-[(3-hydroxyphenyl)methylidene]propanedinitrile |
|---|---|
| PubChem CID | 158719602 |
| Molecular Formula | C20H13N3O5 |
| Molecular Weight | 375.34 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 2-cyano-3-(2,5-dihydroxyphenyl)prop-2-enoic acid;2-[(3-hydroxyphenyl)methylidene]propanedinitrile |
| SMILES | N#CC(=Cc1cc(O)ccc1O)C(=O)O.N#CC(C#N)=Cc1cccc(O)c1 |
| InChI | InChI=1S/C10H6N2O.C10H7NO4/c11-6-9(7-12)4-8-2-1-3-10(13)5-8;11-5-7(10(14)15)3-6-4-8(12)1-2-9(6)13/h1-5,13H;1-4,12-13H,(H,14,15) |
| InChIKey | IJTAKDOARWPNMS-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 169.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.34 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|