C17H12N2O8 — CID 158501700
2-cyano-3-(3-hydroxyphenyl)prop-2-enoic acid;3-hydroxy-4-nitrobenzoic acid (PubChem CID 158501700) has the molecular formula C17H12N2O8 and a molecular weight of 372.29 g/mol. Its IUPAC name is 2-cyano-3-(3-hydroxyphenyl)prop-2-enoic acid;3-hydroxy-4-nitrobenzoic acid.
| Compound Name | 2-cyano-3-(3-hydroxyphenyl)prop-2-enoic acid;3-hydroxy-4-nitrobenzoic acid |
|---|---|
| PubChem CID | 158501700 |
| Molecular Formula | C17H12N2O8 |
| Molecular Weight | 372.29 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | 2-cyano-3-(3-hydroxyphenyl)prop-2-enoic acid;3-hydroxy-4-nitrobenzoic acid |
| SMILES | N#CC(=Cc1cccc(O)c1)C(=O)O.O=C(O)c1ccc([N+](=O)[O-])c(O)c1 |
| InChI | InChI=1S/C10H7NO3.C7H5NO5/c11-6-8(10(13)14)4-7-2-1-3-9(12)5-7;9-6-3-4(7(10)11)1-2-5(6)8(12)13/h1-5,12H,(H,13,14);1-3,9H,(H,10,11) |
| InChIKey | HJYWNCMYNCIKON-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 181.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.29 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|