About prop-2-enyl (E)-2-cyano-3-(4-hydroxy-3-nitrophenyl)prop-2-enoate
prop-2-enyl (E)-2-cyano-3-(4-hydroxy-3-nitrophenyl)prop-2-enoate (PubChem CID 7972771) has the molecular formula C13H10N2O5
and a molecular weight of 274.23 g/mol. Its IUPAC name is prop-2-enyl (E)-2-cyano-3-(4-hydroxy-3-nitrophenyl)prop-2-enoate.
Molecular Properties
| Compound Name | prop-2-enyl (E)-2-cyano-3-(4-hydroxy-3-nitrophenyl)prop-2-enoate |
| PubChem CID | 7972771 |
| Molecular Formula | C13H10N2O5 |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | prop-2-enyl (E)-2-cyano-3-(4-hydroxy-3-nitrophenyl)prop-2-enoate |
| SMILES | C=CCOC(=O)/C(C#N)=C/c1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H10N2O5/c1-2-5-20-13(17)10(8-14)6-9-3-4-12(16)11(7-9)15(18)19/h2-4,6-7,16H,1,5H2/b10-6+ |
| InChIKey | BOSXFSIFXIBRLF-UXBLZVDNSA-N |
| XLogP | 1.94 |
| TPSA | 113.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl (E)-2-cyano-3-(4-hydroxy-3-nitrophenyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl (E)-2-cyano-3-(4-hydroxy-3-nitrophenyl)prop-2-enoate?
The IUPAC name of prop-2-enyl (E)-2-cyano-3-(4-hydroxy-3-nitrophenyl)prop-2-enoate (CID 7972771) is prop-2-enyl (E)-2-cyano-3-(4-hydroxy-3-nitrophenyl)prop-2-enoate.
What is the SMILES notation for prop-2-enyl (E)-2-cyano-3-(4-hydroxy-3-nitrophenyl)prop-2-enoate?
The canonical SMILES for prop-2-enyl (E)-2-cyano-3-(4-hydroxy-3-nitrophenyl)prop-2-enoate is C=CCOC(=O)/C(C#N)=C/c1ccc(O)c([N+](=O)[O-])c1.
What is the InChIKey of prop-2-enyl (E)-2-cyano-3-(4-hydroxy-3-nitrophenyl)prop-2-enoate?
The InChIKey is BOSXFSIFXIBRLF-UXBLZVDNSA-N. The full InChI is InChI=1S/C13H10N2O5/c1-2-5-20-13(17)10(8-14)6-9-3-4-12(16)11(7-9)15(18)19/h2-4,6-7,16H,1,5H2/b10-6+.
What are the key properties of prop-2-enyl (E)-2-cyano-3-(4-hydroxy-3-nitrophenyl)prop-2-enoate?
prop-2-enyl (E)-2-cyano-3-(4-hydroxy-3-nitrophenyl)prop-2-enoate has a molecular weight of 274.23 g/mol, XLogP of 1.94, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl (E)-2-cyano-3-(4-hydroxy-3-nitrophenyl)prop-2-enoate is sourced from PubChem (CID 7972771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).