C16H9Cl2N3O4 — CID 19574936
(Z)-2-cyano-N-(2,3-dichlorophenyl)-3-(4-hydroxy-3-nitrophenyl)prop-2-enamide (PubChem CID 19574936) has the molecular formula C16H9Cl2N3O4 and a molecular weight of 378.17 g/mol. Its IUPAC name is (Z)-2-cyano-N-(2,3-dichlorophenyl)-3-(4-hydroxy-3-nitrophenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(2,3-dichlorophenyl)-3-(4-hydroxy-3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 19574936 |
| Molecular Formula | C16H9Cl2N3O4 |
| Molecular Weight | 378.17 g/mol |
| Exact Mass | 377.00 |
| IUPAC Name | (Z)-2-cyano-N-(2,3-dichlorophenyl)-3-(4-hydroxy-3-nitrophenyl)prop-2-enamide |
| SMILES | N#C/C(=C/c1ccc(O)c([N+](=O)[O-])c1)C(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C16H9Cl2N3O4/c17-11-2-1-3-12(15(11)18)20-16(23)10(8-19)6-9-4-5-14(22)13(7-9)21(24)25/h1-7,22H,(H,20,23)/b10-6- |
| InChIKey | POTRAIWLELMNOC-POHAHGRESA-N |
| XLogP | 4.15 |
| TPSA | 116.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.17 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|