C17H12N3O4- — CID 7333267
4-[(E)-2-cyano-3-(2-methylanilino)-3-oxoprop-1-enyl]-2-nitrophenolate (PubChem CID 7333267) has the molecular formula C17H12N3O4- and a molecular weight of 322.30 g/mol. Its IUPAC name is 4-[(E)-2-cyano-3-(2-methylanilino)-3-oxoprop-1-enyl]-2-nitrophenolate.
| Compound Name | 4-[(E)-2-cyano-3-(2-methylanilino)-3-oxoprop-1-enyl]-2-nitrophenolate |
|---|---|
| PubChem CID | 7333267 |
| Molecular Formula | C17H12N3O4- |
| Molecular Weight | 322.30 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 4-[(E)-2-cyano-3-(2-methylanilino)-3-oxoprop-1-enyl]-2-nitrophenolate |
| SMILES | Cc1ccccc1NC(=O)/C(C#N)=C/c1ccc([O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H13N3O4/c1-11-4-2-3-5-14(11)19-17(22)13(10-18)8-12-6-7-16(21)15(9-12)20(23)24/h2-9,21H,1H3,(H,19,22)/p-1/b13-8+ |
| InChIKey | RYJQQYLKVJWSDD-MDWZMJQESA-M |
| XLogP | 2.52 |
| TPSA | 119.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.30 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|