C19H14N4O7 — CID 18266916
(E)-2-cyano-3-(4-methyl-3-nitrophenyl)-N-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enamide (PubChem CID 18266916) has the molecular formula C19H14N4O7 and a molecular weight of 410.34 g/mol. Its IUPAC name is (E)-2-cyano-3-(4-methyl-3-nitrophenyl)-N-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-(4-methyl-3-nitrophenyl)-N-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enamide |
|---|---|
| PubChem CID | 18266916 |
| Molecular Formula | C19H14N4O7 |
| Molecular Weight | 410.34 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | (E)-2-cyano-3-(4-methyl-3-nitrophenyl)-N-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enamide |
| SMILES | Cc1ccc(/C=C(\C#N)C(=O)Nc2cc3c(cc2[N+](=O)[O-])OCCO3)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H14N4O7/c1-11-2-3-12(7-15(11)22(25)26)6-13(10-20)19(24)21-14-8-17-18(30-5-4-29-17)9-16(14)23(27)28/h2-3,6-9H,4-5H2,1H3,(H,21,24)/b13-6+ |
| InChIKey | NJADABOXCXEUAI-AWNIVKPZSA-N |
| XLogP | 3.13 |
| TPSA | 157.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|