C16H11NO3 — CID 142661598
2-(2,5-dihydroxybenzoyl)-3-phenylprop-2-enenitrile (PubChem CID 142661598) has the molecular formula C16H11NO3 and a molecular weight of 265.27 g/mol. Its IUPAC name is 2-(2,5-dihydroxybenzoyl)-3-phenylprop-2-enenitrile.
| Compound Name | 2-(2,5-dihydroxybenzoyl)-3-phenylprop-2-enenitrile |
|---|---|
| PubChem CID | 142661598 |
| Molecular Formula | C16H11NO3 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 2-(2,5-dihydroxybenzoyl)-3-phenylprop-2-enenitrile |
| SMILES | N#CC(=Cc1ccccc1)C(=O)c1cc(O)ccc1O |
| InChI | InChI=1S/C16H11NO3/c17-10-12(8-11-4-2-1-3-5-11)16(20)14-9-13(18)6-7-15(14)19/h1-9,18-19H |
| InChIKey | OVXLYVNAXJVXBA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 81.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|