C21H23N3O3S — CID 139314944
tert-butyl (E)-2-cyano-3-[6-[2-cyanoethyl(2-hydroxyethyl)amino]-1-benzothiophen-2-yl]prop-2-enoate (PubChem CID 139314944) has the molecular formula C21H23N3O3S and a molecular weight of 397.50 g/mol. Its IUPAC name is tert-butyl (E)-2-cyano-3-[6-[2-cyanoethyl(2-hydroxyethyl)amino]-1-benzothiophen-2-yl]prop-2-enoate.
| Compound Name | tert-butyl (E)-2-cyano-3-[6-[2-cyanoethyl(2-hydroxyethyl)amino]-1-benzothiophen-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 139314944 |
| Molecular Formula | C21H23N3O3S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | tert-butyl (E)-2-cyano-3-[6-[2-cyanoethyl(2-hydroxyethyl)amino]-1-benzothiophen-2-yl]prop-2-enoate |
| SMILES | CC(C)(C)OC(=O)/C(C#N)=C/c1cc2ccc(N(CCO)CCC#N)cc2s1 |
| InChI | InChI=1S/C21H23N3O3S/c1-21(2,3)27-20(26)16(14-23)12-18-11-15-5-6-17(13-19(15)28-18)24(9-10-25)8-4-7-22/h5-6,11-13,25H,4,8-10H2,1-3H3/b16-12+ |
| InChIKey | KISSBEMKQGQYBC-FOWTUZBSSA-N |
| XLogP | 3.86 |
| TPSA | 97.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|