C29H41ClN4O6S — CID 154614997
tert-butyl (E)-3-[6-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethylcarbamoyloxy]ethyl-methylamino]-1,3-benzothiazol-2-yl]-2-cyanoprop-2-enoate (PubChem CID 154614997) has the molecular formula C29H41ClN4O6S and a molecular weight of 609.19 g/mol. Its IUPAC name is tert-butyl (E)-3-[6-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethylcarbamoyloxy]ethyl-methylamino]-1,3-benzothiazol-2-yl]-2-cyanoprop-2-enoate.
| Compound Name | tert-butyl (E)-3-[6-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethylcarbamoyloxy]ethyl-methylamino]-1,3-benzothiazol-2-yl]-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 154614997 |
| Molecular Formula | C29H41ClN4O6S |
| Molecular Weight | 609.19 g/mol |
| Exact Mass | 608.24 |
| IUPAC Name | tert-butyl (E)-3-[6-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethylcarbamoyloxy]ethyl-methylamino]-1,3-benzothiazol-2-yl]-2-cyanoprop-2-enoate |
| SMILES | CN(CCOC(=O)NCCOCCOCCCCCCCl)c1ccc2nc(/C=C(\C#N)C(=O)OC(C)(C)C)sc2c1 |
| InChI | InChI=1S/C29H41ClN4O6S/c1-29(2,3)40-27(35)22(21-31)19-26-33-24-10-9-23(20-25(24)41-26)34(4)13-16-39-28(36)32-12-15-38-18-17-37-14-8-6-5-7-11-30/h9-10,19-20H,5-8,11-18H2,1-4H3,(H,32,36)/b22-19+ |
| InChIKey | YNVSMMSSFQREPP-ZBJSNUHESA-N |
| XLogP | 5.54 |
| TPSA | 123.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.19 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|