C24H34ClN3O6 — CID 152984155
(E)-3-[4-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethylcarbamoyloxy]ethyl-methylamino]phenyl]-2-cyanoprop-2-enoic acid (PubChem CID 152984155) has the molecular formula C24H34ClN3O6 and a molecular weight of 496.00 g/mol. Its IUPAC name is (E)-3-[4-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethylcarbamoyloxy]ethyl-methylamino]phenyl]-2-cyanoprop-2-enoic acid.
| Compound Name | (E)-3-[4-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethylcarbamoyloxy]ethyl-methylamino]phenyl]-2-cyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 152984155 |
| Molecular Formula | C24H34ClN3O6 |
| Molecular Weight | 496.00 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | (E)-3-[4-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethylcarbamoyloxy]ethyl-methylamino]phenyl]-2-cyanoprop-2-enoic acid |
| SMILES | CN(CCOC(=O)NCCOCCOCCCCCCCl)c1ccc(/C=C(\C#N)C(=O)O)cc1 |
| InChI | InChI=1S/C24H34ClN3O6/c1-28(22-8-6-20(7-9-22)18-21(19-26)23(29)30)12-15-34-24(31)27-11-14-33-17-16-32-13-5-3-2-4-10-25/h6-9,18H,2-5,10-17H2,1H3,(H,27,31)(H,29,30)/b21-18+ |
| InChIKey | UUZDDTXOFBLUIW-DYTRJAOYSA-N |
| XLogP | 3.67 |
| TPSA | 121.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.00 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|