C22H37ClN2O7 — CID 172504544
2-[2-(2-pyridin-4-yloxyethoxy)ethoxy]ethyl N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]carbamate (PubChem CID 172504544) has the molecular formula C22H37ClN2O7 and a molecular weight of 477.00 g/mol. Its IUPAC name is 2-[2-(2-pyridin-4-yloxyethoxy)ethoxy]ethyl N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]carbamate.
| Compound Name | 2-[2-(2-pyridin-4-yloxyethoxy)ethoxy]ethyl N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 172504544 |
| Molecular Formula | C22H37ClN2O7 |
| Molecular Weight | 477.00 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | 2-[2-(2-pyridin-4-yloxyethoxy)ethoxy]ethyl N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]carbamate |
| SMILES | O=C(NCCOCCOCCCCCCCl)OCCOCCOCCOc1ccncc1 |
| InChI | InChI=1S/C22H37ClN2O7/c23-7-3-1-2-4-11-27-13-14-28-12-10-25-22(26)32-20-18-30-16-15-29-17-19-31-21-5-8-24-9-6-21/h5-6,8-9H,1-4,7,10-20H2,(H,25,26) |
| InChIKey | MLDUYYSLGOJYDD-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 97.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.00 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|