C19H25Cl2NO7 — CID 57069602
2-[2-[2-[2-(3,5-dichlorophenoxy)ethoxy]ethoxy]ethoxycarbonylamino]ethyl 2-methylprop-2-enoate (PubChem CID 57069602) has the molecular formula C19H25Cl2NO7 and a molecular weight of 450.32 g/mol. Its IUPAC name is 2-[2-[2-[2-(3,5-dichlorophenoxy)ethoxy]ethoxy]ethoxycarbonylamino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-[2-[2-(3,5-dichlorophenoxy)ethoxy]ethoxy]ethoxycarbonylamino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 57069602 |
| Molecular Formula | C19H25Cl2NO7 |
| Molecular Weight | 450.32 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | 2-[2-[2-[2-(3,5-dichlorophenoxy)ethoxy]ethoxy]ethoxycarbonylamino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)OCCOCCOCCOc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C19H25Cl2NO7/c1-14(2)18(23)28-4-3-22-19(24)29-10-8-26-6-5-25-7-9-27-17-12-15(20)11-16(21)13-17/h11-13H,1,3-10H2,2H3,(H,22,24) |
| InChIKey | NGNBUKHBCJPLSN-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.32 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|