C17H21Br2NO6 — CID 56976207
2-[2-[2-(3,5-dibromophenoxy)ethoxy]ethoxycarbonylamino]ethyl 2-methylprop-2-enoate (PubChem CID 56976207) has the molecular formula C17H21Br2NO6 and a molecular weight of 495.16 g/mol. Its IUPAC name is 2-[2-[2-(3,5-dibromophenoxy)ethoxy]ethoxycarbonylamino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-[2-(3,5-dibromophenoxy)ethoxy]ethoxycarbonylamino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 56976207 |
| Molecular Formula | C17H21Br2NO6 |
| Molecular Weight | 495.16 g/mol |
| Exact Mass | 492.97 |
| IUPAC Name | 2-[2-[2-(3,5-dibromophenoxy)ethoxy]ethoxycarbonylamino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)OCCOCCOc1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C17H21Br2NO6/c1-12(2)16(21)25-4-3-20-17(22)26-8-6-23-5-7-24-15-10-13(18)9-14(19)11-15/h9-11H,1,3-8H2,2H3,(H,20,22) |
| InChIKey | PVWHXJDSFBMKGL-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.16 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|