C27H29Br4NO8 — CID 167071208
2-[2-[2,6-dibromo-4-[2-[3,5-dibromo-4-(2-formyloxyethoxy)phenyl]propan-2-yl]phenoxy]ethoxycarbonylamino]ethyl 2-methylprop-2-enoate (PubChem CID 167071208) has the molecular formula C27H29Br4NO8 and a molecular weight of 815.14 g/mol. Its IUPAC name is 2-[2-[2,6-dibromo-4-[2-[3,5-dibromo-4-(2-formyloxyethoxy)phenyl]propan-2-yl]phenoxy]ethoxycarbonylamino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-[2,6-dibromo-4-[2-[3,5-dibromo-4-(2-formyloxyethoxy)phenyl]propan-2-yl]phenoxy]ethoxycarbonylamino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 167071208 |
| Molecular Formula | C27H29Br4NO8 |
| Molecular Weight | 815.14 g/mol |
| Exact Mass | 810.86 |
| IUPAC Name | 2-[2-[2,6-dibromo-4-[2-[3,5-dibromo-4-(2-formyloxyethoxy)phenyl]propan-2-yl]phenoxy]ethoxycarbonylamino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)OCCOc1c(Br)cc(C(C)(C)c2cc(Br)c(OCCOC=O)c(Br)c2)cc1Br |
| InChI | InChI=1S/C27H29Br4NO8/c1-16(2)25(34)39-6-5-32-26(35)40-10-9-38-24-21(30)13-18(14-22(24)31)27(3,4)17-11-19(28)23(20(29)12-17)37-8-7-36-15-33/h11-15H,1,5-10H2,2-4H3,(H,32,35) |
| InChIKey | NPIRLLBBRSQVCD-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.14 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|