C44H54N2O10 — CID 145446970
2-[2-[4-[1-(4-cyclohexylphenyl)-1-[4-[2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]ethoxy]phenyl]ethyl]phenoxy]ethoxycarbonylamino]ethyl 2-methylprop-2-enoate (PubChem CID 145446970) has the molecular formula C44H54N2O10 and a molecular weight of 770.92 g/mol. Its IUPAC name is 2-[2-[4-[1-(4-cyclohexylphenyl)-1-[4-[2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]ethoxy]phenyl]ethyl]phenoxy]ethoxycarbonylamino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-[4-[1-(4-cyclohexylphenyl)-1-[4-[2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]ethoxy]phenyl]ethyl]phenoxy]ethoxycarbonylamino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 145446970 |
| Molecular Formula | C44H54N2O10 |
| Molecular Weight | 770.92 g/mol |
| Exact Mass | 770.38 |
| IUPAC Name | 2-[2-[4-[1-(4-cyclohexylphenyl)-1-[4-[2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]ethoxy]phenyl]ethyl]phenoxy]ethoxycarbonylamino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)OCCOc1ccc(C(C)(c2ccc(OCCOC(=O)NCCOC(=O)C(=C)C)cc2)c2ccc(C3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C44H54N2O10/c1-31(2)40(47)53-25-23-45-42(49)55-29-27-51-38-19-15-36(16-20-38)44(5,35-13-11-34(12-14-35)33-9-7-6-8-10-33)37-17-21-39(22-18-37)52-28-30-56-43(50)46-24-26-54-41(48)32(3)4/h11-22,33H,1,3,6-10,23-30H2,2,4-5H3,(H,45,49)(H,46,50) |
| InChIKey | JVHVBLYYUQIMND-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 147.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.92 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|