C34H31NO5 — CID 135250995
2-[2-[4-(9-phenylfluoren-9-yl)phenoxy]ethoxycarbonylamino]ethyl 2-methylprop-2-enoate (PubChem CID 135250995) has the molecular formula C34H31NO5 and a molecular weight of 533.62 g/mol. Its IUPAC name is 2-[2-[4-(9-phenylfluoren-9-yl)phenoxy]ethoxycarbonylamino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-[4-(9-phenylfluoren-9-yl)phenoxy]ethoxycarbonylamino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 135250995 |
| Molecular Formula | C34H31NO5 |
| Molecular Weight | 533.62 g/mol |
| Exact Mass | 533.22 |
| IUPAC Name | 2-[2-[4-(9-phenylfluoren-9-yl)phenoxy]ethoxycarbonylamino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)OCCOc1ccc(C2(c3ccccc3)c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C34H31NO5/c1-24(2)32(36)39-21-20-35-33(37)40-23-22-38-27-18-16-26(17-19-27)34(25-10-4-3-5-11-25)30-14-8-6-12-28(30)29-13-7-9-15-31(29)34/h3-19H,1,20-23H2,2H3,(H,35,37) |
| InChIKey | DIARHWOEZKNSFN-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.62 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|