C39H34O6 — CID 66717671
2-methyl-6-[4-[9-[4-(5-methyl-3,4-dioxohex-5-enoxy)phenyl]fluoren-9-yl]phenoxy]hex-1-ene-3,4-dione (PubChem CID 66717671) has the molecular formula C39H34O6 and a molecular weight of 598.70 g/mol. Its IUPAC name is 2-methyl-6-[4-[9-[4-(5-methyl-3,4-dioxohex-5-enoxy)phenyl]fluoren-9-yl]phenoxy]hex-1-ene-3,4-dione.
| Compound Name | 2-methyl-6-[4-[9-[4-(5-methyl-3,4-dioxohex-5-enoxy)phenyl]fluoren-9-yl]phenoxy]hex-1-ene-3,4-dione |
|---|---|
| PubChem CID | 66717671 |
| Molecular Formula | C39H34O6 |
| Molecular Weight | 598.70 g/mol |
| Exact Mass | 598.24 |
| IUPAC Name | 2-methyl-6-[4-[9-[4-(5-methyl-3,4-dioxohex-5-enoxy)phenyl]fluoren-9-yl]phenoxy]hex-1-ene-3,4-dione |
| SMILES | C=C(C)C(=O)C(=O)CCOc1ccc(C2(c3ccc(OCCC(=O)C(=O)C(=C)C)cc3)c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C39H34O6/c1-25(2)37(42)35(40)21-23-44-29-17-13-27(14-18-29)39(33-11-7-5-9-31(33)32-10-6-8-12-34(32)39)28-15-19-30(20-16-28)45-24-22-36(41)38(43)26(3)4/h5-20H,1,3,21-24H2,2,4H3 |
| InChIKey | JBLKMJOUNCGRAT-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.70 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|