C34H28O5 — CID 118227614
[4-[9-[4-(3-methyl-2-oxobut-3-enoxy)phenyl]fluoren-9-yl]phenyl] 2-methylprop-2-eneperoxoate (PubChem CID 118227614) has the molecular formula C34H28O5 and a molecular weight of 516.59 g/mol. Its IUPAC name is [4-[9-[4-(3-methyl-2-oxobut-3-enoxy)phenyl]fluoren-9-yl]phenyl] 2-methylprop-2-eneperoxoate.
| Compound Name | [4-[9-[4-(3-methyl-2-oxobut-3-enoxy)phenyl]fluoren-9-yl]phenyl] 2-methylprop-2-eneperoxoate |
|---|---|
| PubChem CID | 118227614 |
| Molecular Formula | C34H28O5 |
| Molecular Weight | 516.59 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | [4-[9-[4-(3-methyl-2-oxobut-3-enoxy)phenyl]fluoren-9-yl]phenyl] 2-methylprop-2-eneperoxoate |
| SMILES | C=C(C)C(=O)COc1ccc(C2(c3ccc(OOC(=O)C(=C)C)cc3)c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C34H28O5/c1-22(2)32(35)21-37-26-17-13-24(14-18-26)34(25-15-19-27(20-16-25)38-39-33(36)23(3)4)30-11-7-5-9-28(30)29-10-6-8-12-31(29)34/h5-20H,1,3,21H2,2,4H3 |
| InChIKey | LJBFLCJNSNDLFB-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.59 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|