C47H44O10 — CID 76556549
[3-[4-[9-[4-[2,3-bis(2-methylprop-2-enoyloxy)prop-1-enoxy]phenyl]fluoren-9-yl]phenoxy]-2-(2-methylprop-2-enoyloxy)propyl] 2-methylprop-2-enoate (PubChem CID 76556549) has the molecular formula C47H44O10 and a molecular weight of 768.86 g/mol. Its IUPAC name is [3-[4-[9-[4-[2,3-bis(2-methylprop-2-enoyloxy)prop-1-enoxy]phenyl]fluoren-9-yl]phenoxy]-2-(2-methylprop-2-enoyloxy)propyl] 2-methylprop-2-enoate.
| Compound Name | [3-[4-[9-[4-[2,3-bis(2-methylprop-2-enoyloxy)prop-1-enoxy]phenyl]fluoren-9-yl]phenoxy]-2-(2-methylprop-2-enoyloxy)propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 76556549 |
| Molecular Formula | C47H44O10 |
| Molecular Weight | 768.86 g/mol |
| Exact Mass | 768.29 |
| IUPAC Name | [3-[4-[9-[4-[2,3-bis(2-methylprop-2-enoyloxy)prop-1-enoxy]phenyl]fluoren-9-yl]phenoxy]-2-(2-methylprop-2-enoyloxy)propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(=COc1ccc(C2(c3ccc(OCC(COC(=O)C(=C)C)OC(=O)C(=C)C)cc3)c3ccccc3-c3ccccc32)cc1)OC(=O)C(=C)C |
| InChI | InChI=1S/C47H44O10/c1-29(2)43(48)54-27-37(56-45(50)31(5)6)25-52-35-21-17-33(18-22-35)47(41-15-11-9-13-39(41)40-14-10-12-16-42(40)47)34-19-23-36(24-20-34)53-26-38(57-46(51)32(7)8)28-55-44(49)30(3)4/h9-25,38H,1,3,5,7,26-28H2,2,4,6,8H3 |
| InChIKey | IPNNOODKQIJFMX-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.86 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|