C33H30O2 — CID 18704292
9,9-bis[4-(2-methylprop-2-enoxy)phenyl]fluorene (PubChem CID 18704292) has the molecular formula C33H30O2 and a molecular weight of 458.60 g/mol. Its IUPAC name is 9,9-bis[4-(2-methylprop-2-enoxy)phenyl]fluorene.
| Compound Name | 9,9-bis[4-(2-methylprop-2-enoxy)phenyl]fluorene |
|---|---|
| PubChem CID | 18704292 |
| Molecular Formula | C33H30O2 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | 9,9-bis[4-(2-methylprop-2-enoxy)phenyl]fluorene |
| SMILES | C=C(C)COc1ccc(C2(c3ccc(OCC(=C)C)cc3)c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C33H30O2/c1-23(2)21-34-27-17-13-25(14-18-27)33(26-15-19-28(20-16-26)35-22-24(3)4)31-11-7-5-9-29(31)30-10-6-8-12-32(30)33/h5-20H,1,3,21-22H2,2,4H3 |
| InChIKey | VWDYTUXDPZJRTM-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|