C38H59ClN2O17 — CID 148680259
[(Z)-4-[4-[2-[2-(4-nitrophenoxy)carbonyloxyethoxy]ethoxy]butanoyloxy]but-2-enyl] 4-[2-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethylcarbamoyloxy]ethoxy]ethoxy]butanoate (PubChem CID 148680259) has the molecular formula C38H59ClN2O17 and a molecular weight of 851.34 g/mol. Its IUPAC name is [(Z)-4-[4-[2-[2-(4-nitrophenoxy)carbonyloxyethoxy]ethoxy]butanoyloxy]but-2-enyl] 4-[2-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethylcarbamoyloxy]ethoxy]ethoxy]butanoate.
| Compound Name | [(Z)-4-[4-[2-[2-(4-nitrophenoxy)carbonyloxyethoxy]ethoxy]butanoyloxy]but-2-enyl] 4-[2-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethylcarbamoyloxy]ethoxy]ethoxy]butanoate |
|---|---|
| PubChem CID | 148680259 |
| Molecular Formula | C38H59ClN2O17 |
| Molecular Weight | 851.34 g/mol |
| Exact Mass | 850.35 |
| IUPAC Name | [(Z)-4-[4-[2-[2-(4-nitrophenoxy)carbonyloxyethoxy]ethoxy]butanoyloxy]but-2-enyl] 4-[2-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethylcarbamoyloxy]ethoxy]ethoxy]butanoate |
| SMILES | O=C(CCCOCCOCCOC(=O)NCCOCCOCCCCCCCl)OC/C=C\COC(=O)CCCOCCOCCOC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C38H59ClN2O17/c39-15-3-1-2-4-17-48-23-26-51-22-16-40-37(44)56-31-29-52-27-24-49-18-7-9-35(42)54-20-5-6-21-55-36(43)10-8-19-50-25-28-53-30-32-57-38(45)58-34-13-11-33(12-14-34)41(46)47/h5-6,11-14H,1-4,7-10,15-32H2,(H,40,44)/b6-5- |
| InChIKey | NRLKXQCYBYHRGD-WAYWQWQTSA-N |
| XLogP | 4.94 |
| TPSA | 224.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.34 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|