C31H43ClN2O13 — CID 158084344
[4-[2-[2-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-5-methyl-2-nitrophenyl]methyl (4-nitrophenyl) carbonate (PubChem CID 158084344) has the molecular formula C31H43ClN2O13 and a molecular weight of 687.14 g/mol. Its IUPAC name is [4-[2-[2-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-5-methyl-2-nitrophenyl]methyl (4-nitrophenyl) carbonate.
| Compound Name | [4-[2-[2-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-5-methyl-2-nitrophenyl]methyl (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 158084344 |
| Molecular Formula | C31H43ClN2O13 |
| Molecular Weight | 687.14 g/mol |
| Exact Mass | 686.25 |
| IUPAC Name | [4-[2-[2-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-5-methyl-2-nitrophenyl]methyl (4-nitrophenyl) carbonate |
| SMILES | Cc1cc(COC(=O)Oc2ccc([N+](=O)[O-])cc2)c([N+](=O)[O-])cc1OCCOCCOCCOCCOCCOCCCCCCCl |
| InChI | InChI=1S/C31H43ClN2O13/c1-25-22-26(24-46-31(35)47-28-8-6-27(7-9-28)33(36)37)29(34(38)39)23-30(25)45-21-20-44-19-18-43-17-16-42-15-14-41-13-12-40-11-5-3-2-4-10-32/h6-9,22-23H,2-5,10-21,24H2,1H3 |
| InChIKey | FNIGGEAUBMNBED-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 177.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.14 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|