C12H18N2O4 — CID 114088127
2-[2-(2,4-dimethyl-5-nitrophenoxy)ethoxy]ethanamine (PubChem CID 114088127) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is 2-[2-(2,4-dimethyl-5-nitrophenoxy)ethoxy]ethanamine.
| Compound Name | 2-[2-(2,4-dimethyl-5-nitrophenoxy)ethoxy]ethanamine |
|---|---|
| PubChem CID | 114088127 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 2-[2-(2,4-dimethyl-5-nitrophenoxy)ethoxy]ethanamine |
| SMILES | Cc1cc(C)c([N+](=O)[O-])cc1OCCOCCN |
| InChI | InChI=1S/C12H18N2O4/c1-9-7-10(2)12(8-11(9)14(15)16)18-6-5-17-4-3-13/h7-8H,3-6,13H2,1-2H3 |
| InChIKey | NFVDZTSWVIZTPQ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|