C30H45ClN2O13 — CID 157460426
[(Z)-4-(4-nitrophenoxy)carbonyloxybut-2-enyl] 4-[2-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethylcarbamoyloxy]ethoxy]ethoxy]butanoate (PubChem CID 157460426) has the molecular formula C30H45ClN2O13 and a molecular weight of 677.14 g/mol. Its IUPAC name is [(Z)-4-(4-nitrophenoxy)carbonyloxybut-2-enyl] 4-[2-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethylcarbamoyloxy]ethoxy]ethoxy]butanoate.
| Compound Name | [(Z)-4-(4-nitrophenoxy)carbonyloxybut-2-enyl] 4-[2-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethylcarbamoyloxy]ethoxy]ethoxy]butanoate |
|---|---|
| PubChem CID | 157460426 |
| Molecular Formula | C30H45ClN2O13 |
| Molecular Weight | 677.14 g/mol |
| Exact Mass | 676.26 |
| IUPAC Name | [(Z)-4-(4-nitrophenoxy)carbonyloxybut-2-enyl] 4-[2-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethylcarbamoyloxy]ethoxy]ethoxy]butanoate |
| SMILES | O=C(CCCOCCOCCOC(=O)NCCOCCOCCCCCCCl)OC/C=C\COC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C30H45ClN2O13/c31-13-3-1-2-4-15-39-20-22-41-19-14-32-29(35)44-25-24-42-23-21-40-16-7-8-28(34)43-17-5-6-18-45-30(36)46-27-11-9-26(10-12-27)33(37)38/h5-6,9-12H,1-4,7-8,13-25H2,(H,32,35)/b6-5- |
| InChIKey | BTVYCONCIUHTCM-WAYWQWQTSA-N |
| XLogP | 4.58 |
| TPSA | 180.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.14 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|