C20H27NO9 — CID 158534822
[(Z)-pent-2-enyl] 4-[2-[2-(4-nitrophenoxy)carbonyloxyethoxy]ethoxy]butanoate (PubChem CID 158534822) has the molecular formula C20H27NO9 and a molecular weight of 425.43 g/mol. Its IUPAC name is [(Z)-pent-2-enyl] 4-[2-[2-(4-nitrophenoxy)carbonyloxyethoxy]ethoxy]butanoate.
| Compound Name | [(Z)-pent-2-enyl] 4-[2-[2-(4-nitrophenoxy)carbonyloxyethoxy]ethoxy]butanoate |
|---|---|
| PubChem CID | 158534822 |
| Molecular Formula | C20H27NO9 |
| Molecular Weight | 425.43 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | [(Z)-pent-2-enyl] 4-[2-[2-(4-nitrophenoxy)carbonyloxyethoxy]ethoxy]butanoate |
| SMILES | CC/C=C\COC(=O)CCCOCCOCCOC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H27NO9/c1-2-3-4-12-28-19(22)6-5-11-26-13-14-27-15-16-29-20(23)30-18-9-7-17(8-10-18)21(24)25/h3-4,7-10H,2,5-6,11-16H2,1H3/b4-3- |
| InChIKey | IIUSDCQNODHUEF-ARJAWSKDSA-N |
| XLogP | 3.43 |
| TPSA | 123.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|