C18H20N2O11 — CID 142032361
formaldehyde;2-[2-[(3E)-5-nitrohexa-1,3,5-trien-2-yl]peroxyethoxy]ethyl (4-nitrophenyl) carbonate (PubChem CID 142032361) has the molecular formula C18H20N2O11 and a molecular weight of 440.36 g/mol. Its IUPAC name is formaldehyde;2-[2-[(3E)-5-nitrohexa-1,3,5-trien-2-yl]peroxyethoxy]ethyl (4-nitrophenyl) carbonate.
| Compound Name | formaldehyde;2-[2-[(3E)-5-nitrohexa-1,3,5-trien-2-yl]peroxyethoxy]ethyl (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 142032361 |
| Molecular Formula | C18H20N2O11 |
| Molecular Weight | 440.36 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | formaldehyde;2-[2-[(3E)-5-nitrohexa-1,3,5-trien-2-yl]peroxyethoxy]ethyl (4-nitrophenyl) carbonate |
| SMILES | C=C(/C=C/C(=C)[N+](=O)[O-])OOCCOCCOC(=O)Oc1ccc([N+](=O)[O-])cc1.C=O |
| InChI | InChI=1S/C17H18N2O10.CH2O/c1-13(18(21)22)3-4-14(2)29-27-12-10-25-9-11-26-17(20)28-16-7-5-15(6-8-16)19(23)24;1-2/h3-8H,1-2,9-12H2;1H2/b4-3+; |
| InChIKey | DYWLMMOWNKHTFK-BJILWQEISA-N |
| XLogP | 2.75 |
| TPSA | 166.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|