C30H37ClN4O4S — CID 154614902
2-[4-[(E)-2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]-N-methylanilino]ethyl N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]carbamate (PubChem CID 154614902) has the molecular formula C30H37ClN4O4S and a molecular weight of 585.17 g/mol. Its IUPAC name is 2-[4-[(E)-2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]-N-methylanilino]ethyl N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]carbamate.
| Compound Name | 2-[4-[(E)-2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]-N-methylanilino]ethyl N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 154614902 |
| Molecular Formula | C30H37ClN4O4S |
| Molecular Weight | 585.17 g/mol |
| Exact Mass | 584.22 |
| IUPAC Name | 2-[4-[(E)-2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]-N-methylanilino]ethyl N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]carbamate |
| SMILES | CN(CCOC(=O)NCCOCCOCCCCCCCl)c1ccc(/C=C(\C#N)c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C30H37ClN4O4S/c1-35(16-19-39-30(36)33-15-18-38-21-20-37-17-7-3-2-6-14-31)26-12-10-24(11-13-26)22-25(23-32)29-34-27-8-4-5-9-28(27)40-29/h4-5,8-13,22H,2-3,6-7,14-21H2,1H3,(H,33,36)/b25-22+ |
| InChIKey | DTMFWYYPHHJRJJ-YYDJUVGSSA-N |
| XLogP | 6.36 |
| TPSA | 96.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.17 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|