C25H34ClN3O4S2 — CID 154614923
2-[[5-[5-[(Z)-2-cyanoethenyl]thiophen-2-yl]thiophen-2-yl]-methylamino]ethyl N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]carbamate (PubChem CID 154614923) has the molecular formula C25H34ClN3O4S2 and a molecular weight of 540.15 g/mol. Its IUPAC name is 2-[[5-[5-[(Z)-2-cyanoethenyl]thiophen-2-yl]thiophen-2-yl]-methylamino]ethyl N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]carbamate.
| Compound Name | 2-[[5-[5-[(Z)-2-cyanoethenyl]thiophen-2-yl]thiophen-2-yl]-methylamino]ethyl N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 154614923 |
| Molecular Formula | C25H34ClN3O4S2 |
| Molecular Weight | 540.15 g/mol |
| Exact Mass | 539.17 |
| IUPAC Name | 2-[[5-[5-[(Z)-2-cyanoethenyl]thiophen-2-yl]thiophen-2-yl]-methylamino]ethyl N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]carbamate |
| SMILES | CN(CCOC(=O)NCCOCCOCCCCCCCl)c1ccc(-c2ccc(/C=C\C#N)s2)s1 |
| InChI | InChI=1S/C25H34ClN3O4S2/c1-29(24-11-10-23(35-24)22-9-8-21(34-22)7-6-13-27)15-18-33-25(30)28-14-17-32-20-19-31-16-5-3-2-4-12-26/h6-11H,2-5,12,14-20H2,1H3,(H,28,30)/b7-6- |
| InChIKey | JTZXTYWAPJSLAS-SREVYHEPSA-N |
| XLogP | 6.01 |
| TPSA | 83.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.15 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|