C25H44ClN3O4 — CID 170193895
tert-butyl N-[3-[4-[3-[[4-[2-chloroethyl(methyl)amino]phenyl]methylamino]propoxy]butoxy]propyl]carbamate (PubChem CID 170193895) has the molecular formula C25H44ClN3O4 and a molecular weight of 486.10 g/mol. Its IUPAC name is tert-butyl N-[3-[4-[3-[[4-[2-chloroethyl(methyl)amino]phenyl]methylamino]propoxy]butoxy]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-[3-[[4-[2-chloroethyl(methyl)amino]phenyl]methylamino]propoxy]butoxy]propyl]carbamate |
|---|---|
| PubChem CID | 170193895 |
| Molecular Formula | C25H44ClN3O4 |
| Molecular Weight | 486.10 g/mol |
| Exact Mass | 485.30 |
| IUPAC Name | tert-butyl N-[3-[4-[3-[[4-[2-chloroethyl(methyl)amino]phenyl]methylamino]propoxy]butoxy]propyl]carbamate |
| SMILES | CN(CCCl)c1ccc(CNCCCOCCCCOCCCNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C25H44ClN3O4/c1-25(2,3)33-24(30)28-15-8-20-32-18-6-5-17-31-19-7-14-27-21-22-9-11-23(12-10-22)29(4)16-13-26/h9-12,27H,5-8,13-21H2,1-4H3,(H,28,30) |
| InChIKey | CTLADONXUYSXHZ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.10 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|