C20H34N2O5 — CID 139356835
tert-butyl N-[3-[5-(N-hydroxy-4-methylanilino)oxypentoxy]propyl]carbamate (PubChem CID 139356835) has the molecular formula C20H34N2O5 and a molecular weight of 382.50 g/mol. Its IUPAC name is tert-butyl N-[3-[5-(N-hydroxy-4-methylanilino)oxypentoxy]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[5-(N-hydroxy-4-methylanilino)oxypentoxy]propyl]carbamate |
|---|---|
| PubChem CID | 139356835 |
| Molecular Formula | C20H34N2O5 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | tert-butyl N-[3-[5-(N-hydroxy-4-methylanilino)oxypentoxy]propyl]carbamate |
| SMILES | Cc1ccc(N(O)OCCCCCOCCCNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C20H34N2O5/c1-17-9-11-18(12-10-17)22(24)26-16-7-5-6-14-25-15-8-13-21-19(23)27-20(2,3)4/h9-12,24H,5-8,13-16H2,1-4H3,(H,21,23) |
| InChIKey | BFIYYWXXCPLXNG-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|