C14H29NO4 — CID 170396360
tert-butyl N-[3-(3-propoxypropoxy)propyl]carbamate (PubChem CID 170396360) has the molecular formula C14H29NO4 and a molecular weight of 275.39 g/mol. Its IUPAC name is tert-butyl N-[3-(3-propoxypropoxy)propyl]carbamate.
| Compound Name | tert-butyl N-[3-(3-propoxypropoxy)propyl]carbamate |
|---|---|
| PubChem CID | 170396360 |
| Molecular Formula | C14H29NO4 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.21 |
| IUPAC Name | tert-butyl N-[3-(3-propoxypropoxy)propyl]carbamate |
| SMILES | CCCOCCCOCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H29NO4/c1-5-9-17-11-7-12-18-10-6-8-15-13(16)19-14(2,3)4/h5-12H2,1-4H3,(H,15,16) |
| InChIKey | JZFKXLHNPONBME-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|