C21H23N3O6 — CID 123915590
2-(2-methylprop-2-enoyloxy)ethyl 2-cyano-3-[4-[2-cyanoethyl(2-hydroxyethyl)amino]-2-hydroxyphenyl]prop-2-enoate (PubChem CID 123915590) has the molecular formula C21H23N3O6 and a molecular weight of 413.43 g/mol. Its IUPAC name is 2-(2-methylprop-2-enoyloxy)ethyl 2-cyano-3-[4-[2-cyanoethyl(2-hydroxyethyl)amino]-2-hydroxyphenyl]prop-2-enoate.
| Compound Name | 2-(2-methylprop-2-enoyloxy)ethyl 2-cyano-3-[4-[2-cyanoethyl(2-hydroxyethyl)amino]-2-hydroxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 123915590 |
| Molecular Formula | C21H23N3O6 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 2-(2-methylprop-2-enoyloxy)ethyl 2-cyano-3-[4-[2-cyanoethyl(2-hydroxyethyl)amino]-2-hydroxyphenyl]prop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)C(C#N)=Cc1ccc(N(CCO)CCC#N)cc1O |
| InChI | InChI=1S/C21H23N3O6/c1-15(2)20(27)29-10-11-30-21(28)17(14-23)12-16-4-5-18(13-19(16)26)24(8-9-25)7-3-6-22/h4-5,12-13,25-26H,1,3,7-11H2,2H3 |
| InChIKey | WSDOJCRBVQLQSO-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 143.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|