About 2-methoxyethyl (E)-2-cyano-3-(2-iodophenyl)prop-2-enoate
2-methoxyethyl (E)-2-cyano-3-(2-iodophenyl)prop-2-enoate (PubChem CID 2688488) has the molecular formula C13H12INO3
and a molecular weight of 357.15 g/mol. Its IUPAC name is 2-methoxyethyl (E)-2-cyano-3-(2-iodophenyl)prop-2-enoate.
Molecular Properties
| Compound Name | 2-methoxyethyl (E)-2-cyano-3-(2-iodophenyl)prop-2-enoate |
| PubChem CID | 2688488 |
| Molecular Formula | C13H12INO3 |
| Molecular Weight | 357.15 g/mol |
| Exact Mass | 356.99 |
| IUPAC Name | 2-methoxyethyl (E)-2-cyano-3-(2-iodophenyl)prop-2-enoate |
| SMILES | COCCOC(=O)/C(C#N)=C/c1ccccc1I |
| InChI | InChI=1S/C13H12INO3/c1-17-6-7-18-13(16)11(9-15)8-10-4-2-3-5-12(10)14/h2-5,8H,6-7H2,1H3/b11-8+ |
| InChIKey | WRZSNWSEPHFGIB-DHZHZOJOSA-N |
| XLogP | 2.39 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.15 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxyethyl (E)-2-cyano-3-(2-iodophenyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxyethyl (E)-2-cyano-3-(2-iodophenyl)prop-2-enoate?
The IUPAC name of 2-methoxyethyl (E)-2-cyano-3-(2-iodophenyl)prop-2-enoate (CID 2688488) is 2-methoxyethyl (E)-2-cyano-3-(2-iodophenyl)prop-2-enoate.
What is the SMILES notation for 2-methoxyethyl (E)-2-cyano-3-(2-iodophenyl)prop-2-enoate?
The canonical SMILES for 2-methoxyethyl (E)-2-cyano-3-(2-iodophenyl)prop-2-enoate is COCCOC(=O)/C(C#N)=C/c1ccccc1I.
What is the InChIKey of 2-methoxyethyl (E)-2-cyano-3-(2-iodophenyl)prop-2-enoate?
The InChIKey is WRZSNWSEPHFGIB-DHZHZOJOSA-N. The full InChI is InChI=1S/C13H12INO3/c1-17-6-7-18-13(16)11(9-15)8-10-4-2-3-5-12(10)14/h2-5,8H,6-7H2,1H3/b11-8+.
What are the key properties of 2-methoxyethyl (E)-2-cyano-3-(2-iodophenyl)prop-2-enoate?
2-methoxyethyl (E)-2-cyano-3-(2-iodophenyl)prop-2-enoate has a molecular weight of 357.15 g/mol, XLogP of 2.39, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxyethyl (E)-2-cyano-3-(2-iodophenyl)prop-2-enoate is sourced from PubChem (CID 2688488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).