C26H30N2O6S — CID 3991245
diethyl 5-[3-cyano-4-[4-(diethylamino)-2-hydroxyphenyl]-2-oxobut-3-enyl]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 3991245) has the molecular formula C26H30N2O6S and a molecular weight of 498.60 g/mol. Its IUPAC name is diethyl 5-[3-cyano-4-[4-(diethylamino)-2-hydroxyphenyl]-2-oxobut-3-enyl]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | diethyl 5-[3-cyano-4-[4-(diethylamino)-2-hydroxyphenyl]-2-oxobut-3-enyl]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 3991245 |
| Molecular Formula | C26H30N2O6S |
| Molecular Weight | 498.60 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | diethyl 5-[3-cyano-4-[4-(diethylamino)-2-hydroxyphenyl]-2-oxobut-3-enyl]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(CC(=O)C(C#N)=Cc2ccc(N(CC)CC)cc2O)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C26H30N2O6S/c1-6-28(7-2)19-11-10-17(20(29)13-19)12-18(15-27)21(30)14-22-23(25(31)33-8-3)16(5)24(35-22)26(32)34-9-4/h10-13,29H,6-9,14H2,1-5H3 |
| InChIKey | QUNJLQQHHXTSLJ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 116.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.60 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|