C27H30N4O7S — CID 124548206
diethyl 5-[(Z)-3-cyano-4-[4-(4-methylpiperazin-1-yl)-3-nitrophenyl]-2-oxobut-3-enyl]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 124548206) has the molecular formula C27H30N4O7S and a molecular weight of 554.63 g/mol. Its IUPAC name is diethyl 5-[(Z)-3-cyano-4-[4-(4-methylpiperazin-1-yl)-3-nitrophenyl]-2-oxobut-3-enyl]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | diethyl 5-[(Z)-3-cyano-4-[4-(4-methylpiperazin-1-yl)-3-nitrophenyl]-2-oxobut-3-enyl]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 124548206 |
| Molecular Formula | C27H30N4O7S |
| Molecular Weight | 554.63 g/mol |
| Exact Mass | 554.18 |
| IUPAC Name | diethyl 5-[(Z)-3-cyano-4-[4-(4-methylpiperazin-1-yl)-3-nitrophenyl]-2-oxobut-3-enyl]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(CC(=O)/C(C#N)=C\c2ccc(N3CCN(C)CC3)c([N+](=O)[O-])c2)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C27H30N4O7S/c1-5-37-26(33)24-17(3)25(27(34)38-6-2)39-23(24)15-22(32)19(16-28)13-18-7-8-20(21(14-18)31(35)36)30-11-9-29(4)10-12-30/h7-8,13-14H,5-6,9-12,15H2,1-4H3/b19-13- |
| InChIKey | VYHMALHNGRQKRM-UYRXBGFRSA-N |
| XLogP | 3.79 |
| TPSA | 143.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.63 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|