C25H27NO6S — CID 4662153
diethyl 5-[3-cyano-2-oxo-4-(4-propan-2-yloxyphenyl)but-3-enyl]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 4662153) has the molecular formula C25H27NO6S and a molecular weight of 469.56 g/mol. Its IUPAC name is diethyl 5-[3-cyano-2-oxo-4-(4-propan-2-yloxyphenyl)but-3-enyl]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | diethyl 5-[3-cyano-2-oxo-4-(4-propan-2-yloxyphenyl)but-3-enyl]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 4662153 |
| Molecular Formula | C25H27NO6S |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | diethyl 5-[3-cyano-2-oxo-4-(4-propan-2-yloxyphenyl)but-3-enyl]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(CC(=O)C(C#N)=Cc2ccc(OC(C)C)cc2)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C25H27NO6S/c1-6-30-24(28)22-16(5)23(25(29)31-7-2)33-21(22)13-20(27)18(14-26)12-17-8-10-19(11-9-17)32-15(3)4/h8-12,15H,6-7,13H2,1-5H3 |
| InChIKey | NRNQPNKKNSDWRY-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 102.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|